C19H23NOS — CID 143759514
N-methyl-N-[(4E)-3-naphthalen-1-yloxyhepta-4,6-dienyl]sulfanylmethanamine (PubChem CID 143759514) has the molecular formula C19H23NOS and a molecular weight of 313.47 g/mol. Its IUPAC name is N-methyl-N-[(4E)-3-naphthalen-1-yloxyhepta-4,6-dienyl]sulfanylmethanamine.
| Compound Name | N-methyl-N-[(4E)-3-naphthalen-1-yloxyhepta-4,6-dienyl]sulfanylmethanamine |
|---|---|
| PubChem CID | 143759514 |
| Molecular Formula | C19H23NOS |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-methyl-N-[(4E)-3-naphthalen-1-yloxyhepta-4,6-dienyl]sulfanylmethanamine |
| SMILES | C=C/C=C/C(CCSN(C)C)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C19H23NOS/c1-4-5-11-17(14-15-22-20(2)3)21-19-13-8-10-16-9-6-7-12-18(16)19/h4-13,17H,1,14-15H2,2-3H3/b11-5+ |
| InChIKey | LLQWYJBJALXRQW-VZUCSPMQSA-N |
| XLogP | 4.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|