C35H43N3 — CID 15858785
(2S)-2-N-[(2S)-2-(4,4-diphenylbutylamino)-3-phenylpropyl]-1-N-methyl-3-phenylpropane-1,2-diamine (PubChem CID 15858785) has the molecular formula C35H43N3 and a molecular weight of 505.75 g/mol. Its IUPAC name is (2S)-2-N-[(2S)-2-(4,4-diphenylbutylamino)-3-phenylpropyl]-1-N-methyl-3-phenylpropane-1,2-diamine.
| Compound Name | (2S)-2-N-[(2S)-2-(4,4-diphenylbutylamino)-3-phenylpropyl]-1-N-methyl-3-phenylpropane-1,2-diamine |
|---|---|
| PubChem CID | 15858785 |
| Molecular Formula | C35H43N3 |
| Molecular Weight | 505.75 g/mol |
| Exact Mass | 505.35 |
| IUPAC Name | (2S)-2-N-[(2S)-2-(4,4-diphenylbutylamino)-3-phenylpropyl]-1-N-methyl-3-phenylpropane-1,2-diamine |
| SMILES | CNC[C@H](Cc1ccccc1)NC[C@H](Cc1ccccc1)NCCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H43N3/c1-36-27-33(25-29-15-6-2-7-16-29)38-28-34(26-30-17-8-3-9-18-30)37-24-14-23-35(31-19-10-4-11-20-31)32-21-12-5-13-22-32/h2-13,15-22,33-38H,14,23-28H2,1H3/t33-,34-/m0/s1 |
| InChIKey | NWSIKDOFTGQNFX-HEVIKAOCSA-N |
| XLogP | 6.22 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.75 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|