C28H43N3 — CID 24793491
(2R)-3-cyclohexyl-1-N-[(2R)-1-(methylamino)-3-phenylpropan-2-yl]-2-N-(3-phenylpropyl)propane-1,2-diamine (PubChem CID 24793491) has the molecular formula C28H43N3 and a molecular weight of 421.67 g/mol. Its IUPAC name is (2R)-3-cyclohexyl-1-N-[(2R)-1-(methylamino)-3-phenylpropan-2-yl]-2-N-(3-phenylpropyl)propane-1,2-diamine.
| Compound Name | (2R)-3-cyclohexyl-1-N-[(2R)-1-(methylamino)-3-phenylpropan-2-yl]-2-N-(3-phenylpropyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 24793491 |
| Molecular Formula | C28H43N3 |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.35 |
| IUPAC Name | (2R)-3-cyclohexyl-1-N-[(2R)-1-(methylamino)-3-phenylpropan-2-yl]-2-N-(3-phenylpropyl)propane-1,2-diamine |
| SMILES | CNC[C@@H](Cc1ccccc1)NC[C@@H](CC1CCCCC1)NCCCc1ccccc1 |
| InChI | InChI=1S/C28H43N3/c1-29-22-27(20-25-14-7-3-8-15-25)31-23-28(21-26-16-9-4-10-17-26)30-19-11-18-24-12-5-2-6-13-24/h2-3,5-8,12-15,26-31H,4,9-11,16-23H2,1H3/t27-,28-/m1/s1 |
| InChIKey | OXFYWPFKKIAGTJ-VSGBNLITSA-N |
| XLogP | 4.97 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|