C26H42N4 — CID 100929641
1-N,6-N,6-N-trimethyl-2-N-[(2S)-3-phenyl-2-(2-phenylethylamino)propyl]hexane-1,2,6-triamine (PubChem CID 100929641) has the molecular formula C26H42N4 and a molecular weight of 410.65 g/mol. Its IUPAC name is 1-N,6-N,6-N-trimethyl-2-N-[(2S)-3-phenyl-2-(2-phenylethylamino)propyl]hexane-1,2,6-triamine.
| Compound Name | 1-N,6-N,6-N-trimethyl-2-N-[(2S)-3-phenyl-2-(2-phenylethylamino)propyl]hexane-1,2,6-triamine |
|---|---|
| PubChem CID | 100929641 |
| Molecular Formula | C26H42N4 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | 1-N,6-N,6-N-trimethyl-2-N-[(2S)-3-phenyl-2-(2-phenylethylamino)propyl]hexane-1,2,6-triamine |
| SMILES | CNCC(CCCCN(C)C)NC[C@H](Cc1ccccc1)NCCc1ccccc1 |
| InChI | InChI=1S/C26H42N4/c1-27-21-25(16-10-11-19-30(2)3)29-22-26(20-24-14-8-5-9-15-24)28-18-17-23-12-6-4-7-13-23/h4-9,12-15,25-29H,10-11,16-22H2,1-3H3/t25?,26-/m0/s1 |
| InChIKey | GYQGADOURJBCHA-AMVUTOCUSA-N |
| XLogP | 3.34 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|