C15H27NO — CID 173447731
N,N-dimethyl-7-phenylheptan-1-amine;hydrate (PubChem CID 173447731) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is N,N-dimethyl-7-phenylheptan-1-amine;hydrate.
| Compound Name | N,N-dimethyl-7-phenylheptan-1-amine;hydrate |
|---|---|
| PubChem CID | 173447731 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | N,N-dimethyl-7-phenylheptan-1-amine;hydrate |
| SMILES | CN(C)CCCCCCCc1ccccc1.O |
| InChI | InChI=1S/C15H25N.H2O/c1-16(2)14-10-5-3-4-7-11-15-12-8-6-9-13-15;/h6,8-9,12-13H,3-5,7,10-11,14H2,1-2H3;1H2 |
| InChIKey | IXDMCSVMSAWOHF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|