C21H39NO — CID 173447859
N,N-dimethyl-12-(2-methylphenyl)dodecan-1-amine;hydrate (PubChem CID 173447859) has the molecular formula C21H39NO and a molecular weight of 321.55 g/mol. Its IUPAC name is N,N-dimethyl-12-(2-methylphenyl)dodecan-1-amine;hydrate.
| Compound Name | N,N-dimethyl-12-(2-methylphenyl)dodecan-1-amine;hydrate |
|---|---|
| PubChem CID | 173447859 |
| Molecular Formula | C21H39NO |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.30 |
| IUPAC Name | N,N-dimethyl-12-(2-methylphenyl)dodecan-1-amine;hydrate |
| SMILES | Cc1ccccc1CCCCCCCCCCCCN(C)C.O |
| InChI | InChI=1S/C21H37N.H2O/c1-20-16-13-14-18-21(20)17-12-10-8-6-4-5-7-9-11-15-19-22(2)3;/h13-14,16,18H,4-12,15,17,19H2,1-3H3;1H2 |
| InChIKey | LOCLVKBOHPPGJB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|