C17H31NO — CID 173448140
N,N-diethyl-6-(2-methylphenyl)hexan-1-amine;hydrate (PubChem CID 173448140) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is N,N-diethyl-6-(2-methylphenyl)hexan-1-amine;hydrate.
| Compound Name | N,N-diethyl-6-(2-methylphenyl)hexan-1-amine;hydrate |
|---|---|
| PubChem CID | 173448140 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | N,N-diethyl-6-(2-methylphenyl)hexan-1-amine;hydrate |
| SMILES | CCN(CC)CCCCCCc1ccccc1C.O |
| InChI | InChI=1S/C17H29N.H2O/c1-4-18(5-2)15-11-7-6-8-13-17-14-10-9-12-16(17)3;/h9-10,12,14H,4-8,11,13,15H2,1-3H3;1H2 |
| InChIKey | ZOSWXHSWEYZMOT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|