C14H25NO — CID 173447958
N,N-dimethyl-5-(4-methylphenyl)pentan-1-amine;hydrate (PubChem CID 173447958) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is N,N-dimethyl-5-(4-methylphenyl)pentan-1-amine;hydrate.
| Compound Name | N,N-dimethyl-5-(4-methylphenyl)pentan-1-amine;hydrate |
|---|---|
| PubChem CID | 173447958 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N,N-dimethyl-5-(4-methylphenyl)pentan-1-amine;hydrate |
| SMILES | Cc1ccc(CCCCCN(C)C)cc1.O |
| InChI | InChI=1S/C14H23N.H2O/c1-13-8-10-14(11-9-13)7-5-4-6-12-15(2)3;/h8-11H,4-7,12H2,1-3H3;1H2 |
| InChIKey | KGEUNXLWSGEVAI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|