C14H19N — CID 139494263
4-(4-ethynylphenyl)-N,N-dimethylbutan-1-amine (PubChem CID 139494263) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 4-(4-ethynylphenyl)-N,N-dimethylbutan-1-amine.
| Compound Name | 4-(4-ethynylphenyl)-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 139494263 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 4-(4-ethynylphenyl)-N,N-dimethylbutan-1-amine |
| SMILES | C#Cc1ccc(CCCCN(C)C)cc1 |
| InChI | InChI=1S/C14H19N/c1-4-13-8-10-14(11-9-13)7-5-6-12-15(2)3/h1,8-11H,5-7,12H2,2-3H3 |
| InChIKey | PXAFEGQKOFVUGC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|