C22H31N — CID 13230987
N,N-dimethyl-4,8-diphenyloctan-1-amine (PubChem CID 13230987) has the molecular formula C22H31N and a molecular weight of 309.50 g/mol. Its IUPAC name is N,N-dimethyl-4,8-diphenyloctan-1-amine.
| Compound Name | N,N-dimethyl-4,8-diphenyloctan-1-amine |
|---|---|
| PubChem CID | 13230987 |
| Molecular Formula | C22H31N |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | N,N-dimethyl-4,8-diphenyloctan-1-amine |
| SMILES | CN(C)CCCC(CCCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H31N/c1-23(2)19-11-18-22(21-15-7-4-8-16-21)17-10-9-14-20-12-5-3-6-13-20/h3-8,12-13,15-16,22H,9-11,14,17-19H2,1-2H3 |
| InChIKey | MVKRDUOIFKSNAI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|