C14H23NO — CID 171986460
5-methoxy-N,N-dimethyl-4-phenylpentan-1-amine (PubChem CID 171986460) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 5-methoxy-N,N-dimethyl-4-phenylpentan-1-amine.
| Compound Name | 5-methoxy-N,N-dimethyl-4-phenylpentan-1-amine |
|---|---|
| PubChem CID | 171986460 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 5-methoxy-N,N-dimethyl-4-phenylpentan-1-amine |
| SMILES | COCC(CCCN(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H23NO/c1-15(2)11-7-10-14(12-16-3)13-8-5-4-6-9-13/h4-6,8-9,14H,7,10-12H2,1-3H3 |
| InChIKey | QXKLWNUJQQSIGH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |