C19H32ClN — CID 54460837
11-chloro-N,N-dimethyl-11-phenylundecan-1-amine (PubChem CID 54460837) has the molecular formula C19H32ClN and a molecular weight of 309.92 g/mol. Its IUPAC name is 11-chloro-N,N-dimethyl-11-phenylundecan-1-amine.
| Compound Name | 11-chloro-N,N-dimethyl-11-phenylundecan-1-amine |
|---|---|
| PubChem CID | 54460837 |
| Molecular Formula | C19H32ClN |
| Molecular Weight | 309.92 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 11-chloro-N,N-dimethyl-11-phenylundecan-1-amine |
| SMILES | CN(C)CCCCCCCCCCC(Cl)c1ccccc1 |
| InChI | InChI=1S/C19H32ClN/c1-21(2)17-13-8-6-4-3-5-7-12-16-19(20)18-14-10-9-11-15-18/h9-11,14-15,19H,3-8,12-13,16-17H2,1-2H3 |
| InChIKey | XBMFUSYYYNKRBB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.92 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|