C20H27N — CID 122424794
(5R)-N,N-dimethyl-5-(3-methylphenyl)-5-phenylpentan-1-amine (PubChem CID 122424794) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is (5R)-N,N-dimethyl-5-(3-methylphenyl)-5-phenylpentan-1-amine.
| Compound Name | (5R)-N,N-dimethyl-5-(3-methylphenyl)-5-phenylpentan-1-amine |
|---|---|
| PubChem CID | 122424794 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | (5R)-N,N-dimethyl-5-(3-methylphenyl)-5-phenylpentan-1-amine |
| SMILES | Cc1cccc([C@H](CCCCN(C)C)c2ccccc2)c1 |
| InChI | InChI=1S/C20H27N/c1-17-10-9-13-19(16-17)20(14-7-8-15-21(2)3)18-11-5-4-6-12-18/h4-6,9-13,16,20H,7-8,14-15H2,1-3H3/t20-/m1/s1 |
| InChIKey | FIYDTVCCNMIASM-HXUWFJFHSA-N |
| XLogP | 4.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|