C22H31N — CID 23276099
4-(2-tert-butylphenyl)-N,N-dimethyl-4-phenylbutan-1-amine (PubChem CID 23276099) has the molecular formula C22H31N and a molecular weight of 309.50 g/mol. Its IUPAC name is 4-(2-tert-butylphenyl)-N,N-dimethyl-4-phenylbutan-1-amine.
| Compound Name | 4-(2-tert-butylphenyl)-N,N-dimethyl-4-phenylbutan-1-amine |
|---|---|
| PubChem CID | 23276099 |
| Molecular Formula | C22H31N |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | 4-(2-tert-butylphenyl)-N,N-dimethyl-4-phenylbutan-1-amine |
| SMILES | CN(C)CCCC(c1ccccc1)c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C22H31N/c1-22(2,3)21-16-10-9-14-20(21)19(15-11-17-23(4)5)18-12-7-6-8-13-18/h6-10,12-14,16,19H,11,15,17H2,1-5H3 |
| InChIKey | YHLIOZQGKUTCHQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |