C17H28O — CID 115829952
1-(2-tert-butylphenyl)-5-methylhexan-1-ol (PubChem CID 115829952) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-(2-tert-butylphenyl)-5-methylhexan-1-ol.
| Compound Name | 1-(2-tert-butylphenyl)-5-methylhexan-1-ol |
|---|---|
| PubChem CID | 115829952 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 1-(2-tert-butylphenyl)-5-methylhexan-1-ol |
| SMILES | CC(C)CCCC(O)c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C17H28O/c1-13(2)9-8-12-16(18)14-10-6-7-11-15(14)17(3,4)5/h6-7,10-11,13,16,18H,8-9,12H2,1-5H3 |
| InChIKey | OAQZYCQTYWZPPT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |