C14H21BrO — CID 107985814
1-(2-bromo-3-methylphenyl)-5-methylhexan-1-ol (PubChem CID 107985814) has the molecular formula C14H21BrO and a molecular weight of 285.23 g/mol. Its IUPAC name is 1-(2-bromo-3-methylphenyl)-5-methylhexan-1-ol.
| Compound Name | 1-(2-bromo-3-methylphenyl)-5-methylhexan-1-ol |
|---|---|
| PubChem CID | 107985814 |
| Molecular Formula | C14H21BrO |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-(2-bromo-3-methylphenyl)-5-methylhexan-1-ol |
| SMILES | Cc1cccc(C(O)CCCC(C)C)c1Br |
| InChI | InChI=1S/C14H21BrO/c1-10(2)6-4-9-13(16)12-8-5-7-11(3)14(12)15/h5,7-8,10,13,16H,4,6,9H2,1-3H3 |
| InChIKey | AUDGMNSBQYGLTP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |