C15H13Br2ClO — CID 107985833
2-(4-bromo-2-chlorophenyl)-1-(2-bromo-3-methylphenyl)ethanol (PubChem CID 107985833) has the molecular formula C15H13Br2ClO and a molecular weight of 404.53 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenyl)-1-(2-bromo-3-methylphenyl)ethanol.
| Compound Name | 2-(4-bromo-2-chlorophenyl)-1-(2-bromo-3-methylphenyl)ethanol |
|---|---|
| PubChem CID | 107985833 |
| Molecular Formula | C15H13Br2ClO |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 401.90 |
| IUPAC Name | 2-(4-bromo-2-chlorophenyl)-1-(2-bromo-3-methylphenyl)ethanol |
| SMILES | Cc1cccc(C(O)Cc2ccc(Br)cc2Cl)c1Br |
| InChI | InChI=1S/C15H13Br2ClO/c1-9-3-2-4-12(15(9)17)14(19)7-10-5-6-11(16)8-13(10)18/h2-6,8,14,19H,7H2,1H3 |
| InChIKey | ZNIYVRNOXRALHW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |