C15H13BrClFO — CID 107103323
2-(4-bromo-2-fluorophenyl)-1-(3-chloro-2-methylphenyl)ethanol (PubChem CID 107103323) has the molecular formula C15H13BrClFO and a molecular weight of 343.62 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-1-(3-chloro-2-methylphenyl)ethanol.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-1-(3-chloro-2-methylphenyl)ethanol |
|---|---|
| PubChem CID | 107103323 |
| Molecular Formula | C15H13BrClFO |
| Molecular Weight | 343.62 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-1-(3-chloro-2-methylphenyl)ethanol |
| SMILES | Cc1c(Cl)cccc1C(O)Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C15H13BrClFO/c1-9-12(3-2-4-13(9)17)15(19)7-10-5-6-11(16)8-14(10)18/h2-6,8,15,19H,7H2,1H3 |
| InChIKey | HTRQUESVGASVAC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |