C17H19BrO2 — CID 107985716
1-(2-bromo-3-methylphenyl)-3-(4-methoxyphenyl)propan-1-ol (PubChem CID 107985716) has the molecular formula C17H19BrO2 and a molecular weight of 335.24 g/mol. Its IUPAC name is 1-(2-bromo-3-methylphenyl)-3-(4-methoxyphenyl)propan-1-ol.
| Compound Name | 1-(2-bromo-3-methylphenyl)-3-(4-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 107985716 |
| Molecular Formula | C17H19BrO2 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-(2-bromo-3-methylphenyl)-3-(4-methoxyphenyl)propan-1-ol |
| SMILES | COc1ccc(CCC(O)c2cccc(C)c2Br)cc1 |
| InChI | InChI=1S/C17H19BrO2/c1-12-4-3-5-15(17(12)18)16(19)11-8-13-6-9-14(20-2)10-7-13/h3-7,9-10,16,19H,8,11H2,1-2H3 |
| InChIKey | GORISXMUFCGKTA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |