C16H20O2S — CID 61086865
1-(2,5-dimethylthiophen-3-yl)-3-(4-methoxyphenyl)propan-1-ol (PubChem CID 61086865) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)-3-(4-methoxyphenyl)propan-1-ol.
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)-3-(4-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 61086865 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)-3-(4-methoxyphenyl)propan-1-ol |
| SMILES | COc1ccc(CCC(O)c2cc(C)sc2C)cc1 |
| InChI | InChI=1S/C16H20O2S/c1-11-10-15(12(2)19-11)16(17)9-6-13-4-7-14(18-3)8-5-13/h4-5,7-8,10,16-17H,6,9H2,1-3H3 |
| InChIKey | ZJGDWOLNEXHBFV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |