C16H17IO2 — CID 115803162
1-(3-iodophenyl)-3-(4-methoxyphenyl)propan-1-ol (PubChem CID 115803162) has the molecular formula C16H17IO2 and a molecular weight of 368.21 g/mol. Its IUPAC name is 1-(3-iodophenyl)-3-(4-methoxyphenyl)propan-1-ol.
| Compound Name | 1-(3-iodophenyl)-3-(4-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 115803162 |
| Molecular Formula | C16H17IO2 |
| Molecular Weight | 368.21 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 1-(3-iodophenyl)-3-(4-methoxyphenyl)propan-1-ol |
| SMILES | COc1ccc(CCC(O)c2cccc(I)c2)cc1 |
| InChI | InChI=1S/C16H17IO2/c1-19-15-8-5-12(6-9-15)7-10-16(18)13-3-2-4-14(17)11-13/h2-6,8-9,11,16,18H,7,10H2,1H3 |
| InChIKey | HPMSKLBJESCHKA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.21 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|