C17H19ClO3 — CID 115818086
1-(4-chloro-3-methoxyphenyl)-3-(4-methoxyphenyl)propan-1-ol (PubChem CID 115818086) has the molecular formula C17H19ClO3 and a molecular weight of 306.79 g/mol. Its IUPAC name is 1-(4-chloro-3-methoxyphenyl)-3-(4-methoxyphenyl)propan-1-ol.
| Compound Name | 1-(4-chloro-3-methoxyphenyl)-3-(4-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 115818086 |
| Molecular Formula | C17H19ClO3 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-(4-chloro-3-methoxyphenyl)-3-(4-methoxyphenyl)propan-1-ol |
| SMILES | COc1ccc(CCC(O)c2ccc(Cl)c(OC)c2)cc1 |
| InChI | InChI=1S/C17H19ClO3/c1-20-14-7-3-12(4-8-14)5-10-16(19)13-6-9-15(18)17(11-13)21-2/h3-4,6-9,11,16,19H,5,10H2,1-2H3 |
| InChIKey | SVUWPCSIEREURM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |