C21H30ClN — CID 3044120
N,N,2-trimethyl-6,6-diphenylhexan-2-amine;hydrochloride (PubChem CID 3044120) has the molecular formula C21H30ClN and a molecular weight of 331.93 g/mol. Its IUPAC name is N,N,2-trimethyl-6,6-diphenylhexan-2-amine;hydrochloride.
| Compound Name | N,N,2-trimethyl-6,6-diphenylhexan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 3044120 |
| Molecular Formula | C21H30ClN |
| Molecular Weight | 331.93 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | N,N,2-trimethyl-6,6-diphenylhexan-2-amine;hydrochloride |
| SMILES | CN(C)C(C)(C)CCCC(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H29N.ClH/c1-21(2,22(3)4)17-11-16-20(18-12-7-5-8-13-18)19-14-9-6-10-15-19;/h5-10,12-15,20H,11,16-17H2,1-4H3;1H |
| InChIKey | BNHXDSTWFQRWSJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.93 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |