C16H19P — CID 175045111
2,2-bis(3-methylphenyl)ethylphosphane (PubChem CID 175045111) has the molecular formula C16H19P and a molecular weight of 242.30 g/mol. Its IUPAC name is 2,2-bis(3-methylphenyl)ethylphosphane.
| Compound Name | 2,2-bis(3-methylphenyl)ethylphosphane |
|---|---|
| PubChem CID | 175045111 |
| Molecular Formula | C16H19P |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2,2-bis(3-methylphenyl)ethylphosphane |
| SMILES | Cc1cccc(C(CP)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C16H19P/c1-12-5-3-7-14(9-12)16(11-17)15-8-4-6-13(2)10-15/h3-10,16H,11,17H2,1-2H3 |
| InChIKey | BHLQPDVEOSXPAA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|