C9H12S2 — CID 143743400
1-(3-methylphenyl)ethane-1,2-dithiol (PubChem CID 143743400) has the molecular formula C9H12S2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 1-(3-methylphenyl)ethane-1,2-dithiol.
| Compound Name | 1-(3-methylphenyl)ethane-1,2-dithiol |
|---|---|
| PubChem CID | 143743400 |
| Molecular Formula | C9H12S2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 1-(3-methylphenyl)ethane-1,2-dithiol |
| SMILES | Cc1cccc(C(S)CS)c1 |
| InChI | InChI=1S/C9H12S2/c1-7-3-2-4-8(5-7)9(11)6-10/h2-5,9-11H,6H2,1H3 |
| InChIKey | HUUJJHWNIYXMEF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|