C20H30F2 — CID 177243602
1-(difluoromethyl)-3-methylbenzene;ethane;1,3-xylene (PubChem CID 177243602) has the molecular formula C20H30F2 and a molecular weight of 308.46 g/mol. Its IUPAC name is 1-(difluoromethyl)-3-methylbenzene;ethane;1,3-xylene.
| Compound Name | 1-(difluoromethyl)-3-methylbenzene;ethane;1,3-xylene |
|---|---|
| PubChem CID | 177243602 |
| Molecular Formula | C20H30F2 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 1-(difluoromethyl)-3-methylbenzene;ethane;1,3-xylene |
| SMILES | CC.CC.Cc1cccc(C(F)F)c1.Cc1cccc(C)c1 |
| InChI | InChI=1S/C8H8F2.C8H10.2C2H6/c1-6-3-2-4-7(5-6)8(9)10;1-7-4-3-5-8(2)6-7;2*1-2/h2-5,8H,1H3;3-6H,1-2H3;2*1-2H3 |
| InChIKey | RVFLOFXJNYEDHF-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |