C9H9F3 — CID 147922323
1-methyl-3-(1,2,2-trifluoroethyl)benzene (PubChem CID 147922323) has the molecular formula C9H9F3 and a molecular weight of 174.16 g/mol. Its IUPAC name is 1-methyl-3-(1,2,2-trifluoroethyl)benzene.
| Compound Name | 1-methyl-3-(1,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 147922323 |
| Molecular Formula | C9H9F3 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 1-methyl-3-(1,2,2-trifluoroethyl)benzene |
| SMILES | Cc1cccc(C(F)C(F)F)c1 |
| InChI | InChI=1S/C9H9F3/c1-6-3-2-4-7(5-6)8(10)9(11)12/h2-5,8-9H,1H3 |
| InChIKey | IIGVYDSVKKUNPT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |