2,2-bis(3-methylphenyl)ethylphosphonic acid

C16H19O3P — CID 118195001

IUPAC2,2-bis(3-methylphenyl)ethylphosphonic acid
SMILESCc1cccc(C(CP(=O)(O)O)c2cccc(C)c2)c1
InChIInChI=1S/C16H19O3P/c1-12-5-3-7-14(9-12)16(11-20(17,18)19)15-8-4-6-13(2)10-15/h3-10,16H,11H2,1-2H3,(H2,17,18,19)
InChIKeyNONWEVIQNKLMLR-UHFFFAOYSA-N
MW290.30 g/mol
LogP3.61
Rot. Bonds4

About 2,2-bis(3-methylphenyl)ethylphosphonic acid

2,2-bis(3-methylphenyl)ethylphosphonic acid (PubChem CID 118195001) has the molecular formula C16H19O3P and a molecular weight of 290.30 g/mol. Its IUPAC name is 2,2-bis(3-methylphenyl)ethylphosphonic acid.

Molecular Properties

Compound Name2,2-bis(3-methylphenyl)ethylphosphonic acid
PubChem CID118195001
Molecular FormulaC16H19O3P
Molecular Weight290.30 g/mol
Exact Mass290.11
IUPAC Name2,2-bis(3-methylphenyl)ethylphosphonic acid
SMILESCc1cccc(C(CP(=O)(O)O)c2cccc(C)c2)c1
InChIInChI=1S/C16H19O3P/c1-12-5-3-7-14(9-12)16(11-20(17,18)19)15-8-4-6-13(2)10-15/h3-10,16H,11H2,1-2H3,(H2,17,18,19)
InChIKeyNONWEVIQNKLMLR-UHFFFAOYSA-N
XLogP3.61
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.30
LogP ≤ 53.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2,2-bis(3-methylphenyl)ethylphosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-bis(3-methylphenyl)ethylphosphonic acid?
The IUPAC name of 2,2-bis(3-methylphenyl)ethylphosphonic acid (CID 118195001) is 2,2-bis(3-methylphenyl)ethylphosphonic acid.
What is the SMILES notation for 2,2-bis(3-methylphenyl)ethylphosphonic acid?
The canonical SMILES for 2,2-bis(3-methylphenyl)ethylphosphonic acid is Cc1cccc(C(CP(=O)(O)O)c2cccc(C)c2)c1.
What is the InChIKey of 2,2-bis(3-methylphenyl)ethylphosphonic acid?
The InChIKey is NONWEVIQNKLMLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19O3P/c1-12-5-3-7-14(9-12)16(11-20(17,18)19)15-8-4-6-13(2)10-15/h3-10,16H,11H2,1-2H3,(H2,17,18,19).
What are the key properties of 2,2-bis(3-methylphenyl)ethylphosphonic acid?
2,2-bis(3-methylphenyl)ethylphosphonic acid has a molecular weight of 290.30 g/mol, XLogP of 3.61, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(3-methylphenyl)ethylphosphonic acid is sourced from PubChem (CID 118195001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).