C16H19O3P — CID 118195001
2,2-bis(3-methylphenyl)ethylphosphonic acid (PubChem CID 118195001) has the molecular formula C16H19O3P and a molecular weight of 290.30 g/mol. Its IUPAC name is 2,2-bis(3-methylphenyl)ethylphosphonic acid.
| Compound Name | 2,2-bis(3-methylphenyl)ethylphosphonic acid |
|---|---|
| PubChem CID | 118195001 |
| Molecular Formula | C16H19O3P |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2,2-bis(3-methylphenyl)ethylphosphonic acid |
| SMILES | Cc1cccc(C(CP(=O)(O)O)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C16H19O3P/c1-12-5-3-7-14(9-12)16(11-20(17,18)19)15-8-4-6-13(2)10-15/h3-10,16H,11H2,1-2H3,(H2,17,18,19) |
| InChIKey | NONWEVIQNKLMLR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|