C16H15FO2 — CID 42073733
(3S)-3-(4-fluorophenyl)-3-(3-methylphenyl)propanoic acid (PubChem CID 42073733) has the molecular formula C16H15FO2 and a molecular weight of 258.29 g/mol. Its IUPAC name is (3S)-3-(4-fluorophenyl)-3-(3-methylphenyl)propanoic acid.
| Compound Name | (3S)-3-(4-fluorophenyl)-3-(3-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 42073733 |
| Molecular Formula | C16H15FO2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (3S)-3-(4-fluorophenyl)-3-(3-methylphenyl)propanoic acid |
| SMILES | Cc1cccc([C@@H](CC(=O)O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C16H15FO2/c1-11-3-2-4-13(9-11)15(10-16(18)19)12-5-7-14(17)8-6-12/h2-9,15H,10H2,1H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | UDGVYZCDUIRRTK-HNNXBMFYSA-N |
| XLogP | 3.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |