C25H27FNO5P — CID 23882208
3-[(4-fluorophenyl)methyl-[[4-(phosphonomethyl)phenyl]methyl]amino]-3-(3-methylphenyl)propanoic acid (PubChem CID 23882208) has the molecular formula C25H27FNO5P and a molecular weight of 471.47 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl-[[4-(phosphonomethyl)phenyl]methyl]amino]-3-(3-methylphenyl)propanoic acid.
| Compound Name | 3-[(4-fluorophenyl)methyl-[[4-(phosphonomethyl)phenyl]methyl]amino]-3-(3-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 23882208 |
| Molecular Formula | C25H27FNO5P |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl-[[4-(phosphonomethyl)phenyl]methyl]amino]-3-(3-methylphenyl)propanoic acid |
| SMILES | Cc1cccc(C(CC(=O)O)N(Cc2ccc(F)cc2)Cc2ccc(CP(=O)(O)O)cc2)c1 |
| InChI | InChI=1S/C25H27FNO5P/c1-18-3-2-4-22(13-18)24(14-25(28)29)27(16-20-9-11-23(26)12-10-20)15-19-5-7-21(8-6-19)17-33(30,31)32/h2-13,24H,14-17H2,1H3,(H,28,29)(H2,30,31,32) |
| InChIKey | WOSPTDGSAGKTHH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|