C25H25N2O8P — CID 23790606
3-(3-methylphenyl)-3-[(4-nitrobenzoyl)-[[4-(phosphonomethyl)phenyl]methyl]amino]propanoic acid (PubChem CID 23790606) has the molecular formula C25H25N2O8P and a molecular weight of 512.46 g/mol. Its IUPAC name is 3-(3-methylphenyl)-3-[(4-nitrobenzoyl)-[[4-(phosphonomethyl)phenyl]methyl]amino]propanoic acid.
| Compound Name | 3-(3-methylphenyl)-3-[(4-nitrobenzoyl)-[[4-(phosphonomethyl)phenyl]methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23790606 |
| Molecular Formula | C25H25N2O8P |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 3-(3-methylphenyl)-3-[(4-nitrobenzoyl)-[[4-(phosphonomethyl)phenyl]methyl]amino]propanoic acid |
| SMILES | Cc1cccc(C(CC(=O)O)N(Cc2ccc(CP(=O)(O)O)cc2)C(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C25H25N2O8P/c1-17-3-2-4-21(13-17)23(14-24(28)29)26(25(30)20-9-11-22(12-10-20)27(31)32)15-18-5-7-19(8-6-18)16-36(33,34)35/h2-13,23H,14-16H2,1H3,(H,28,29)(H2,33,34,35) |
| InChIKey | CANGEPWCKWKOKU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 158.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|