C22H26NO6P — CID 23855937
3-[cyclopropanecarbonyl-[[4-(phosphonomethyl)phenyl]methyl]amino]-3-(3-methylphenyl)propanoic acid (PubChem CID 23855937) has the molecular formula C22H26NO6P and a molecular weight of 431.43 g/mol. Its IUPAC name is 3-[cyclopropanecarbonyl-[[4-(phosphonomethyl)phenyl]methyl]amino]-3-(3-methylphenyl)propanoic acid.
| Compound Name | 3-[cyclopropanecarbonyl-[[4-(phosphonomethyl)phenyl]methyl]amino]-3-(3-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 23855937 |
| Molecular Formula | C22H26NO6P |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 3-[cyclopropanecarbonyl-[[4-(phosphonomethyl)phenyl]methyl]amino]-3-(3-methylphenyl)propanoic acid |
| SMILES | Cc1cccc(C(CC(=O)O)N(Cc2ccc(CP(=O)(O)O)cc2)C(=O)C2CC2)c1 |
| InChI | InChI=1S/C22H26NO6P/c1-15-3-2-4-19(11-15)20(12-21(24)25)23(22(26)18-9-10-18)13-16-5-7-17(8-6-16)14-30(27,28)29/h2-8,11,18,20H,9-10,12-14H2,1H3,(H,24,25)(H2,27,28,29) |
| InChIKey | LUSHVVAXZZMNKM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|