C36H40N2O2 — CID 143136668
1-N,4-N-bis(3-methylphenyl)-1-N,4-N-diphenylcyclohexane-1,4-dicarboxamide;ethane (PubChem CID 143136668) has the molecular formula C36H40N2O2 and a molecular weight of 532.73 g/mol. Its IUPAC name is 1-N,4-N-bis(3-methylphenyl)-1-N,4-N-diphenylcyclohexane-1,4-dicarboxamide;ethane.
| Compound Name | 1-N,4-N-bis(3-methylphenyl)-1-N,4-N-diphenylcyclohexane-1,4-dicarboxamide;ethane |
|---|---|
| PubChem CID | 143136668 |
| Molecular Formula | C36H40N2O2 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | 1-N,4-N-bis(3-methylphenyl)-1-N,4-N-diphenylcyclohexane-1,4-dicarboxamide;ethane |
| SMILES | CC.Cc1cccc(N(C(=O)C2CCC(C(=O)N(c3ccccc3)c3cccc(C)c3)CC2)c2ccccc2)c1 |
| InChI | InChI=1S/C34H34N2O2.C2H6/c1-25-11-9-17-31(23-25)35(29-13-5-3-6-14-29)33(37)27-19-21-28(22-20-27)34(38)36(30-15-7-4-8-16-30)32-18-10-12-26(2)24-32;1-2/h3-18,23-24,27-28H,19-22H2,1-2H3;1-2H3 |
| InChIKey | ZGLWLEREMINEBQ-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |