C22H34N2O2 — CID 109149897
4-N-ethyl-4-N-(3-methylphenyl)-1-N-pentylcyclohexane-1,4-dicarboxamide (PubChem CID 109149897) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 4-N-ethyl-4-N-(3-methylphenyl)-1-N-pentylcyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-ethyl-4-N-(3-methylphenyl)-1-N-pentylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109149897 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 4-N-ethyl-4-N-(3-methylphenyl)-1-N-pentylcyclohexane-1,4-dicarboxamide |
| SMILES | CCCCCNC(=O)C1CCC(C(=O)N(CC)c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C22H34N2O2/c1-4-6-7-15-23-21(25)18-11-13-19(14-12-18)22(26)24(5-2)20-10-8-9-17(3)16-20/h8-10,16,18-19H,4-7,11-15H2,1-3H3,(H,23,25) |
| InChIKey | CUTMHZKBFYESAW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|