C19H29N3O2 — CID 109134131
2-N-[3-(dimethylamino)propyl]-1-N-ethyl-1-N-(3-methylphenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109134131) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-1-N-ethyl-1-N-(3-methylphenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-1-N-ethyl-1-N-(3-methylphenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109134131 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-1-N-ethyl-1-N-(3-methylphenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | CCN(C(=O)C1CC1C(=O)NCCCN(C)C)c1cccc(C)c1 |
| InChI | InChI=1S/C19H29N3O2/c1-5-22(15-9-6-8-14(2)12-15)19(24)17-13-16(17)18(23)20-10-7-11-21(3)4/h6,8-9,12,16-17H,5,7,10-11,13H2,1-4H3,(H,20,23) |
| InChIKey | KIBBUJWDMNLIOB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|