C18H26N2O2 — CID 109131399
2-N-butyl-1-N-ethyl-1-N-(3-methylphenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109131399) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-N-butyl-1-N-ethyl-1-N-(3-methylphenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-butyl-1-N-ethyl-1-N-(3-methylphenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109131399 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 2-N-butyl-1-N-ethyl-1-N-(3-methylphenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | CCCCNC(=O)C1CC1C(=O)N(CC)c1cccc(C)c1 |
| InChI | InChI=1S/C18H26N2O2/c1-4-6-10-19-17(21)15-12-16(15)18(22)20(5-2)14-9-7-8-13(3)11-14/h7-9,11,15-16H,4-6,10,12H2,1-3H3,(H,19,21) |
| InChIKey | VFBWVKXLEAAQKB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|