C24H21Cl2FNO6P — CID 23826856
3-(3,4-dichlorophenyl)-3-[(3-fluorobenzoyl)-[[4-(phosphonomethyl)phenyl]methyl]amino]propanoic acid (PubChem CID 23826856) has the molecular formula C24H21Cl2FNO6P and a molecular weight of 540.31 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-3-[(3-fluorobenzoyl)-[[4-(phosphonomethyl)phenyl]methyl]amino]propanoic acid.
| Compound Name | 3-(3,4-dichlorophenyl)-3-[(3-fluorobenzoyl)-[[4-(phosphonomethyl)phenyl]methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23826856 |
| Molecular Formula | C24H21Cl2FNO6P |
| Molecular Weight | 540.31 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-3-[(3-fluorobenzoyl)-[[4-(phosphonomethyl)phenyl]methyl]amino]propanoic acid |
| SMILES | O=C(O)CC(c1ccc(Cl)c(Cl)c1)N(Cc1ccc(CP(=O)(O)O)cc1)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C24H21Cl2FNO6P/c25-20-9-8-17(11-21(20)26)22(12-23(29)30)28(24(31)18-2-1-3-19(27)10-18)13-15-4-6-16(7-5-15)14-35(32,33)34/h1-11,22H,12-14H2,(H,29,30)(H2,32,33,34) |
| InChIKey | IAQJVWHAIGHBEI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.31 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|