C24H30Cl2NO5P — CID 23792288
3-[cyclohexylmethyl-[[4-(phosphonomethyl)phenyl]methyl]amino]-3-(3,4-dichlorophenyl)propanoic acid (PubChem CID 23792288) has the molecular formula C24H30Cl2NO5P and a molecular weight of 514.39 g/mol. Its IUPAC name is 3-[cyclohexylmethyl-[[4-(phosphonomethyl)phenyl]methyl]amino]-3-(3,4-dichlorophenyl)propanoic acid.
| Compound Name | 3-[cyclohexylmethyl-[[4-(phosphonomethyl)phenyl]methyl]amino]-3-(3,4-dichlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 23792288 |
| Molecular Formula | C24H30Cl2NO5P |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 3-[cyclohexylmethyl-[[4-(phosphonomethyl)phenyl]methyl]amino]-3-(3,4-dichlorophenyl)propanoic acid |
| SMILES | O=C(O)CC(c1ccc(Cl)c(Cl)c1)N(Cc1ccc(CP(=O)(O)O)cc1)CC1CCCCC1 |
| InChI | InChI=1S/C24H30Cl2NO5P/c25-21-11-10-20(12-22(21)26)23(13-24(28)29)27(14-17-4-2-1-3-5-17)15-18-6-8-19(9-7-18)16-33(30,31)32/h6-12,17,23H,1-5,13-16H2,(H,28,29)(H2,30,31,32) |
| InChIKey | MKYZMXLXLIZWJA-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|