C23H29N2O6P — CID 23852868
3-cyclohexyl-3-[[4-(phosphonomethyl)phenyl]methyl-(pyridine-3-carbonyl)amino]propanoic acid (PubChem CID 23852868) has the molecular formula C23H29N2O6P and a molecular weight of 460.47 g/mol. Its IUPAC name is 3-cyclohexyl-3-[[4-(phosphonomethyl)phenyl]methyl-(pyridine-3-carbonyl)amino]propanoic acid.
| Compound Name | 3-cyclohexyl-3-[[4-(phosphonomethyl)phenyl]methyl-(pyridine-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 23852868 |
| Molecular Formula | C23H29N2O6P |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 3-cyclohexyl-3-[[4-(phosphonomethyl)phenyl]methyl-(pyridine-3-carbonyl)amino]propanoic acid |
| SMILES | O=C(O)CC(C1CCCCC1)N(Cc1ccc(CP(=O)(O)O)cc1)C(=O)c1cccnc1 |
| InChI | InChI=1S/C23H29N2O6P/c26-22(27)13-21(19-5-2-1-3-6-19)25(23(28)20-7-4-12-24-14-20)15-17-8-10-18(11-9-17)16-32(29,30)31/h4,7-12,14,19,21H,1-3,5-6,13,15-16H2,(H,26,27)(H2,29,30,31) |
| InChIKey | CNGQRPAQTSFLON-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|