C15H22N2O2 — CID 141444032
N-[(1S)-1-cycloheptyl-2-hydroxyethyl]pyridine-3-carboxamide (PubChem CID 141444032) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N-[(1S)-1-cycloheptyl-2-hydroxyethyl]pyridine-3-carboxamide.
| Compound Name | N-[(1S)-1-cycloheptyl-2-hydroxyethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141444032 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-[(1S)-1-cycloheptyl-2-hydroxyethyl]pyridine-3-carboxamide |
| SMILES | O=C(N[C@H](CO)C1CCCCCC1)c1cccnc1 |
| InChI | InChI=1S/C15H22N2O2/c18-11-14(12-6-3-1-2-4-7-12)17-15(19)13-8-5-9-16-10-13/h5,8-10,12,14,18H,1-4,6-7,11H2,(H,17,19)/t14-/m1/s1 |
| InChIKey | BASIVZGPHMNSDG-CQSZACIVSA-N |
| XLogP | 2.14 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |