C19H22N6O — CID 53378704
N-[(S)-[1-(1-cyanocyclopropyl)triazol-4-yl]-cyclohexylmethyl]pyridine-3-carboxamide (PubChem CID 53378704) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is N-[(S)-[1-(1-cyanocyclopropyl)triazol-4-yl]-cyclohexylmethyl]pyridine-3-carboxamide.
| Compound Name | N-[(S)-[1-(1-cyanocyclopropyl)triazol-4-yl]-cyclohexylmethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 53378704 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N-[(S)-[1-(1-cyanocyclopropyl)triazol-4-yl]-cyclohexylmethyl]pyridine-3-carboxamide |
| SMILES | N#CC1(n2cc([C@@H](NC(=O)c3cccnc3)C3CCCCC3)nn2)CC1 |
| InChI | InChI=1S/C19H22N6O/c20-13-19(8-9-19)25-12-16(23-24-25)17(14-5-2-1-3-6-14)22-18(26)15-7-4-10-21-11-15/h4,7,10-12,14,17H,1-3,5-6,8-9H2,(H,22,26)/t17-/m0/s1 |
| InChIKey | LALWATJRULEQFU-KRWDZBQOSA-N |
| XLogP | 2.74 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |