C18H27N3O3 — CID 134349860
N-[1-(cyclohexylmethylamino)-2-hydroxy-1-oxopentan-3-yl]pyridine-3-carboxamide (PubChem CID 134349860) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is N-[1-(cyclohexylmethylamino)-2-hydroxy-1-oxopentan-3-yl]pyridine-3-carboxamide.
| Compound Name | N-[1-(cyclohexylmethylamino)-2-hydroxy-1-oxopentan-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134349860 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N-[1-(cyclohexylmethylamino)-2-hydroxy-1-oxopentan-3-yl]pyridine-3-carboxamide |
| SMILES | CCC(NC(=O)c1cccnc1)C(O)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C18H27N3O3/c1-2-15(21-17(23)14-9-6-10-19-12-14)16(22)18(24)20-11-13-7-4-3-5-8-13/h6,9-10,12-13,15-16,22H,2-5,7-8,11H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | KJZKERBCRKFESZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |