C21H35N3O5S — CID 70044027
N-[(2S,3R,4R)-5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]pyridine-3-carboxamide (PubChem CID 70044027) has the molecular formula C21H35N3O5S and a molecular weight of 441.59 g/mol. Its IUPAC name is N-[(2S,3R,4R)-5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[(2S,3R,4R)-5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 70044027 |
| Molecular Formula | C21H35N3O5S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | N-[(2S,3R,4R)-5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]pyridine-3-carboxamide |
| SMILES | CCCCNS(=O)(=O)C[C@H](O)[C@H](O)[C@H](CC1CCCCC1)NC(=O)c1cccnc1 |
| InChI | InChI=1S/C21H35N3O5S/c1-2-3-12-23-30(28,29)15-19(25)20(26)18(13-16-8-5-4-6-9-16)24-21(27)17-10-7-11-22-14-17/h7,10-11,14,16,18-20,23,25-26H,2-6,8-9,12-13,15H2,1H3,(H,24,27)/t18-,19-,20+/m0/s1 |
| InChIKey | PTSIMBQQUKQWKK-SLFFLAALSA-N |
| XLogP | 1.59 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|