C29H49N3O7S — CID 70043942
benzyl N-[(2S)-1-[[(2R,4S)-5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 70043942) has the molecular formula C29H49N3O7S and a molecular weight of 583.79 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2R,4S)-5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2R,4S)-5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 70043942 |
| Molecular Formula | C29H49N3O7S |
| Molecular Weight | 583.79 g/mol |
| Exact Mass | 583.33 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2R,4S)-5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCNS(=O)(=O)C[C@@H](O)C(O)[C@@H](CC1CCCCC1)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H49N3O7S/c1-4-5-16-30-40(37,38)20-26(33)27(34)24(18-22-12-8-6-9-13-22)31-28(35)25(17-21(2)3)32-29(36)39-19-23-14-10-7-11-15-23/h7,10-11,14-15,21-22,24-27,30,33-34H,4-6,8-9,12-13,16-20H2,1-3H3,(H,31,35)(H,32,36)/t24-,25+,26-,27?/m1/s1 |
| InChIKey | XXINXILSGHOMAT-TXVRJSAZSA-N |
| XLogP | 3.22 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.79 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|