C22H38N4O5S — CID 54170333
3,4-diamino-N-[5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]benzamide (PubChem CID 54170333) has the molecular formula C22H38N4O5S and a molecular weight of 470.64 g/mol. Its IUPAC name is 3,4-diamino-N-[5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]benzamide.
| Compound Name | 3,4-diamino-N-[5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]benzamide |
|---|---|
| PubChem CID | 54170333 |
| Molecular Formula | C22H38N4O5S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | 3,4-diamino-N-[5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]benzamide |
| SMILES | CCCCNS(=O)(=O)CC(O)C(O)C(CC1CCCCC1)NC(=O)c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C22H38N4O5S/c1-2-3-11-25-32(30,31)14-20(27)21(28)19(12-15-7-5-4-6-8-15)26-22(29)16-9-10-17(23)18(24)13-16/h9-10,13,15,19-21,25,27-28H,2-8,11-12,14,23-24H2,1H3,(H,26,29) |
| InChIKey | OUOJXUBGACKNAD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|