C23H42N4O5S — CID 70042965
N-[5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]-3-(1H-imidazol-5-yl)pentanamide (PubChem CID 70042965) has the molecular formula C23H42N4O5S and a molecular weight of 486.68 g/mol. Its IUPAC name is N-[5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]-3-(1H-imidazol-5-yl)pentanamide.
| Compound Name | N-[5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]-3-(1H-imidazol-5-yl)pentanamide |
|---|---|
| PubChem CID | 70042965 |
| Molecular Formula | C23H42N4O5S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | N-[5-(butylsulfamoyl)-1-cyclohexyl-3,4-dihydroxypentan-2-yl]-3-(1H-imidazol-5-yl)pentanamide |
| SMILES | CCCCNS(=O)(=O)CC(O)C(O)C(CC1CCCCC1)NC(=O)CC(CC)c1cnc[nH]1 |
| InChI | InChI=1S/C23H42N4O5S/c1-3-5-11-26-33(31,32)15-21(28)23(30)19(12-17-9-7-6-8-10-17)27-22(29)13-18(4-2)20-14-24-16-25-20/h14,16-19,21,23,26,28,30H,3-13,15H2,1-2H3,(H,24,25)(H,27,29) |
| InChIKey | ZVANXAOXIAUHIT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 144.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|