C16H31NO4 — CID 70055412
[(2S,3R)-1-cyclohexyl-5-ethyl-3,4-dihydroxyheptan-2-yl]carbamic acid (PubChem CID 70055412) has the molecular formula C16H31NO4 and a molecular weight of 301.43 g/mol. Its IUPAC name is [(2S,3R)-1-cyclohexyl-5-ethyl-3,4-dihydroxyheptan-2-yl]carbamic acid.
| Compound Name | [(2S,3R)-1-cyclohexyl-5-ethyl-3,4-dihydroxyheptan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 70055412 |
| Molecular Formula | C16H31NO4 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | [(2S,3R)-1-cyclohexyl-5-ethyl-3,4-dihydroxyheptan-2-yl]carbamic acid |
| SMILES | CCC(CC)C(O)[C@H](O)[C@H](CC1CCCCC1)NC(=O)O |
| InChI | InChI=1S/C16H31NO4/c1-3-12(4-2)14(18)15(19)13(17-16(20)21)10-11-8-6-5-7-9-11/h11-15,17-19H,3-10H2,1-2H3,(H,20,21)/t13-,14?,15+/m0/s1 |
| InChIKey | UNUYUGRJCZSYQQ-ZHDDOTHNSA-N |
| XLogP | 2.75 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |