C16H31NO4 — CID 67799084
[(2S,3R)-1-cyclohexyl-5-ethyl-3,4-dihydroxyheptan-2-yl] carbamate (PubChem CID 67799084) has the molecular formula C16H31NO4 and a molecular weight of 301.43 g/mol. Its IUPAC name is [(2S,3R)-1-cyclohexyl-5-ethyl-3,4-dihydroxyheptan-2-yl] carbamate.
| Compound Name | [(2S,3R)-1-cyclohexyl-5-ethyl-3,4-dihydroxyheptan-2-yl] carbamate |
|---|---|
| PubChem CID | 67799084 |
| Molecular Formula | C16H31NO4 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | [(2S,3R)-1-cyclohexyl-5-ethyl-3,4-dihydroxyheptan-2-yl] carbamate |
| SMILES | CCC(CC)C(O)[C@@H](O)[C@H](CC1CCCCC1)OC(N)=O |
| InChI | InChI=1S/C16H31NO4/c1-3-12(4-2)14(18)15(19)13(21-16(17)20)10-11-8-6-5-7-9-11/h11-15,18-19H,3-10H2,1-2H3,(H2,17,20)/t13-,14?,15-/m0/s1 |
| InChIKey | MAUSNWFIMUQSGT-LWEDLAQUSA-N |
| XLogP | 2.58 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |