C12H21NO3 — CID 67723480
[(2S,3R)-1-cyclohexyl-3-hydroxypent-4-en-2-yl] carbamate (PubChem CID 67723480) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is [(2S,3R)-1-cyclohexyl-3-hydroxypent-4-en-2-yl] carbamate.
| Compound Name | [(2S,3R)-1-cyclohexyl-3-hydroxypent-4-en-2-yl] carbamate |
|---|---|
| PubChem CID | 67723480 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | [(2S,3R)-1-cyclohexyl-3-hydroxypent-4-en-2-yl] carbamate |
| SMILES | C=C[C@@H](O)[C@H](CC1CCCCC1)OC(N)=O |
| InChI | InChI=1S/C12H21NO3/c1-2-10(14)11(16-12(13)15)8-9-6-4-3-5-7-9/h2,9-11,14H,1,3-8H2,(H2,13,15)/t10-,11+/m1/s1 |
| InChIKey | KJNUHKMZTJEQGX-MNOVXSKESA-N |
| XLogP | 1.97 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|