C26H47N5O3 — CID 91300232
N-butyl-6-cyclohexyl-4-hydroxy-5-[[3-(1H-imidazol-5-yl)-2-(methylamino)propanoyl]amino]-2-propan-2-ylhexanamide (PubChem CID 91300232) has the molecular formula C26H47N5O3 and a molecular weight of 477.69 g/mol. Its IUPAC name is N-butyl-6-cyclohexyl-4-hydroxy-5-[[3-(1H-imidazol-5-yl)-2-(methylamino)propanoyl]amino]-2-propan-2-ylhexanamide.
| Compound Name | N-butyl-6-cyclohexyl-4-hydroxy-5-[[3-(1H-imidazol-5-yl)-2-(methylamino)propanoyl]amino]-2-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 91300232 |
| Molecular Formula | C26H47N5O3 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.37 |
| IUPAC Name | N-butyl-6-cyclohexyl-4-hydroxy-5-[[3-(1H-imidazol-5-yl)-2-(methylamino)propanoyl]amino]-2-propan-2-ylhexanamide |
| SMILES | CCCCNC(=O)C(CC(O)C(CC1CCCCC1)NC(=O)C(Cc1cnc[nH]1)NC)C(C)C |
| InChI | InChI=1S/C26H47N5O3/c1-5-6-12-29-25(33)21(18(2)3)15-24(32)22(13-19-10-8-7-9-11-19)31-26(34)23(27-4)14-20-16-28-17-30-20/h16-19,21-24,27,32H,5-15H2,1-4H3,(H,28,30)(H,29,33)(H,31,34) |
| InChIKey | RGRPTXJQLQJCPZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|